![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Krackhardt - Cognitive Social Structures.pdf | 2024-10-02 19:00 | 2.7M | |
| SSRN-id2150428.pdf | 2024-10-02 19:00 | 2.2M | |
| Zheng - 2006 - How Many People Do You Know in Prison Using Overdispersion in Count Data to Estimate Social Structure in Networks.pdf | 2024-10-02 19:00 | 607K | |
| a model for social networks.pdf | 2024-10-02 19:00 | 422K | |
| comparative study of dynamic sn models.pdf | 2024-10-02 19:00 | 1.5M | |
| lncs-markov-erg.pdf | 2024-10-02 19:00 | 110K | |
| magfit-uai11.pdf | 2024-10-02 19:00 | 423K | |
| multi-modal-networks-singh2007IV.pdf | 2024-10-02 19:00 | 809K | |
| p2-VanDuijnSnijdersZijlstraStatistica2004.pdf | 2024-10-02 19:00 | 222K | |
| p2-multilevel-zijlstra.pdf | 2024-10-02 19:00 | 335K | |